About methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine
methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine (PubChem CID 142330299) has the molecular formula C13H25F3N2
and a molecular weight of 266.35 g/mol. Its IUPAC name is methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine.
Molecular Properties
| Compound Name | methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine |
| PubChem CID | 142330299 |
| Molecular Formula | C13H25F3N2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine |
| SMILES | CN.FC(F)(F)C1CCCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C12H20F3N.CH5N/c13-12(14,15)10-5-4-6-11(9-10)16-7-2-1-3-8-16;1-2/h10-11H,1-9H2;2H2,1H3 |
| InChIKey | WQUOWQHXKULRFQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine?
The IUPAC name of methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine (CID 142330299) is methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine.
What is the SMILES notation for methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine?
The canonical SMILES for methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine is CN.FC(F)(F)C1CCCC(N2CCCCC2)C1.
What is the InChIKey of methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine?
The InChIKey is WQUOWQHXKULRFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N.CH5N/c13-12(14,15)10-5-4-6-11(9-10)16-7-2-1-3-8-16;1-2/h10-11H,1-9H2;2H2,1H3.
What are the key properties of methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine?
methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine has a molecular weight of 266.35 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-[3-(trifluoromethyl)cyclohexyl]piperidine is sourced from PubChem (CID 142330299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).