C23H27ClN4O4 — CID 142330726
5-[(2-chloro-5-methylphenyl)methoxy]-N-(2-methyl-6-nitrophenyl)pyridin-2-amine;ethane;formamide (PubChem CID 142330726) has the molecular formula C23H27ClN4O4 and a molecular weight of 458.95 g/mol. Its IUPAC name is 5-[(2-chloro-5-methylphenyl)methoxy]-N-(2-methyl-6-nitrophenyl)pyridin-2-amine;ethane;formamide.
| Compound Name | 5-[(2-chloro-5-methylphenyl)methoxy]-N-(2-methyl-6-nitrophenyl)pyridin-2-amine;ethane;formamide |
|---|---|
| PubChem CID | 142330726 |
| Molecular Formula | C23H27ClN4O4 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 5-[(2-chloro-5-methylphenyl)methoxy]-N-(2-methyl-6-nitrophenyl)pyridin-2-amine;ethane;formamide |
| SMILES | CC.Cc1ccc(Cl)c(COc2ccc(Nc3c(C)cccc3[N+](=O)[O-])nc2)c1.NC=O |
| InChI | InChI=1S/C20H18ClN3O3.C2H6.CH3NO/c1-13-6-8-17(21)15(10-13)12-27-16-7-9-19(22-11-16)23-20-14(2)4-3-5-18(20)24(25)26;1-2;2-1-3/h3-11H,12H2,1-2H3,(H,22,23);1-2H3;1H,(H2,2,3) |
| InChIKey | JIZRGBVALQNZSC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 120.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|