About 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one
3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one (PubChem CID 142330789) has the molecular formula C5H7ClN2O2
and a molecular weight of 162.58 g/mol. Its IUPAC name is 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one.
Molecular Properties
| Compound Name | 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one |
| PubChem CID | 142330789 |
| Molecular Formula | C5H7ClN2O2 |
| Molecular Weight | 162.58 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one |
| SMILES | CN1NC(=O)C(O)C=C1Cl |
| InChI | InChI=1S/C5H7ClN2O2/c1-8-4(6)2-3(9)5(10)7-8/h2-3,9H,1H3,(H,7,10) |
| InChIKey | XZRCOQPWVVLZIE-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.58 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one?
The IUPAC name of 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one (CID 142330789) is 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one.
What is the SMILES notation for 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one?
The canonical SMILES for 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one is CN1NC(=O)C(O)C=C1Cl.
What is the InChIKey of 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one?
The InChIKey is XZRCOQPWVVLZIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2O2/c1-8-4(6)2-3(9)5(10)7-8/h2-3,9H,1H3,(H,7,10).
What are the key properties of 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one?
3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one has a molecular weight of 162.58 g/mol, XLogP of -0.60, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-hydroxy-2-methyl-1,5-dihydropyridazin-6-one is sourced from PubChem (CID 142330789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).