About 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol
3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol (PubChem CID 142330908) has the molecular formula C18H34ClFO
and a molecular weight of 320.92 g/mol. Its IUPAC name is 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol.
Molecular Properties
| Compound Name | 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol |
| PubChem CID | 142330908 |
| Molecular Formula | C18H34ClFO |
| Molecular Weight | 320.92 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol |
| SMILES | C=C(CCC(C)C(C)CCCC)C(C)C(F)C(Cl)C(C)O |
| InChI | InChI=1S/C18H34ClFO/c1-7-8-9-12(2)13(3)10-11-14(4)15(5)18(20)17(19)16(6)21/h12-13,15-18,21H,4,7-11H2,1-3,5-6H3 |
| InChIKey | NOIFRWJSHYUYHW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.92 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol?
The IUPAC name of 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol (CID 142330908) is 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol.
What is the SMILES notation for 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol?
The canonical SMILES for 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol is C=C(CCC(C)C(C)CCCC)C(C)C(F)C(Cl)C(C)O.
What is the InChIKey of 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol?
The InChIKey is NOIFRWJSHYUYHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34ClFO/c1-7-8-9-12(2)13(3)10-11-14(4)15(5)18(20)17(19)16(6)21/h12-13,15-18,21H,4,7-11H2,1-3,5-6H3.
What are the key properties of 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol?
3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol has a molecular weight of 320.92 g/mol, XLogP of 5.75, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-fluoro-5,9,10-trimethyl-6-methylidenetetradecan-2-ol is sourced from PubChem (CID 142330908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).