C12H22N6O5 — CID 142331397
2-[[3-(1,5-diaminopentyl)-1,2,4-oxadiazol-5-yl]methylcarbamoylamino]-3-hydroxypropanoic acid (PubChem CID 142331397) has the molecular formula C12H22N6O5 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-[[3-(1,5-diaminopentyl)-1,2,4-oxadiazol-5-yl]methylcarbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[3-(1,5-diaminopentyl)-1,2,4-oxadiazol-5-yl]methylcarbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 142331397 |
| Molecular Formula | C12H22N6O5 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-[[3-(1,5-diaminopentyl)-1,2,4-oxadiazol-5-yl]methylcarbamoylamino]-3-hydroxypropanoic acid |
| SMILES | NCCCCC(N)c1noc(CNC(=O)NC(CO)C(=O)O)n1 |
| InChI | InChI=1S/C12H22N6O5/c13-4-2-1-3-7(14)10-17-9(23-18-10)5-15-12(22)16-8(6-19)11(20)21/h7-8,19H,1-6,13-14H2,(H,20,21)(H2,15,16,22) |
| InChIKey | QNNXFFQLCFPWQA-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 189.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|