C22H26N4O — CID 142331779
1-methyl-3-phenyl-5-[(3,4,6-trimethylcyclohexa-2,4-dien-1-yl)amino]-2,3-dihydroimidazo[1,2-c]pyrimidin-7-one (PubChem CID 142331779) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-methyl-3-phenyl-5-[(3,4,6-trimethylcyclohexa-2,4-dien-1-yl)amino]-2,3-dihydroimidazo[1,2-c]pyrimidin-7-one.
| Compound Name | 1-methyl-3-phenyl-5-[(3,4,6-trimethylcyclohexa-2,4-dien-1-yl)amino]-2,3-dihydroimidazo[1,2-c]pyrimidin-7-one |
|---|---|
| PubChem CID | 142331779 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-methyl-3-phenyl-5-[(3,4,6-trimethylcyclohexa-2,4-dien-1-yl)amino]-2,3-dihydroimidazo[1,2-c]pyrimidin-7-one |
| SMILES | CC1=CC(C)C(Nc2nc(=O)cc3n2C(c2ccccc2)CN3C)C=C1C |
| InChI | InChI=1S/C22H26N4O/c1-14-10-16(3)18(11-15(14)2)23-22-24-20(27)12-21-25(4)13-19(26(21)22)17-8-6-5-7-9-17/h5-12,16,18-19H,13H2,1-4H3,(H,23,24,27) |
| InChIKey | NKAANIWODRLFMS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |