C12H24N2OS — CID 142332371
(NE,S)-N-[(1-ethylpiperidin-4-yl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 142332371) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is (NE,S)-N-[(1-ethylpiperidin-4-yl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,S)-N-[(1-ethylpiperidin-4-yl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 142332371 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (NE,S)-N-[(1-ethylpiperidin-4-yl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CCN1CCC(/C=N/[S@@](=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24N2OS/c1-5-14-8-6-11(7-9-14)10-13-16(15)12(2,3)4/h10-11H,5-9H2,1-4H3/b13-10+/t16-/m0/s1 |
| InChIKey | YHNXUNOOFXRBGK-ISBHARSQSA-N |
| XLogP | 2.25 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|