C30H41F3O3S — CID 142332832
(3S,8S,9S,10R,13R,14R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-8,10,13-trimethyl-3-(trifluoromethyl)-2,4,7,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 142332832) has the molecular formula C30H41F3O3S and a molecular weight of 538.72 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-8,10,13-trimethyl-3-(trifluoromethyl)-2,4,7,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-8,10,13-trimethyl-3-(trifluoromethyl)-2,4,7,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142332832 |
| Molecular Formula | C30H41F3O3S |
| Molecular Weight | 538.72 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | (3S,8S,9S,10R,13R,14R,17R)-17-[(2S)-1-(benzenesulfonyl)propan-2-yl]-8,10,13-trimethyl-3-(trifluoromethyl)-2,4,7,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CS(=O)(=O)c1ccccc1)[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@@]2(C)CC=C2C[C@](O)(C(F)(F)F)CC[C@@]21C |
| InChI | InChI=1S/C30H41F3O3S/c1-20(19-37(35,36)22-8-6-5-7-9-22)23-10-11-24-27(23,3)15-13-25-26(2)16-17-29(34,30(31,32)33)18-21(26)12-14-28(24,25)4/h5-9,12,20,23-25,34H,10-11,13-19H2,1-4H3/t20-,23-,24-,25-,26+,27-,28+,29+/m1/s1 |
| InChIKey | BCNWCECKRYXQQQ-MLXZOPIISA-N |
| XLogP | 7.36 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.72 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|