C34H53F3O4S — CID 142333032
(17R)-17-[3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxyhexyl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol;ethane (PubChem CID 142333032) has the molecular formula C34H53F3O4S and a molecular weight of 614.86 g/mol. Its IUPAC name is (17R)-17-[3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxyhexyl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol;ethane.
| Compound Name | (17R)-17-[3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxyhexyl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol;ethane |
|---|---|
| PubChem CID | 142333032 |
| Molecular Formula | C34H53F3O4S |
| Molecular Weight | 614.86 g/mol |
| Exact Mass | 614.36 |
| IUPAC Name | (17R)-17-[3-(benzenesulfonyl)-6,6,6-trifluoro-5-hydroxyhexyl]-13-methyl-1,2,3,4,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-ol;ethane |
| SMILES | CC.CC.CC12CCC3C4CCC(O)CC4=CCC3C1CC[C@@H]2CCC(CC(O)C(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H41F3O4S.2C2H6/c1-29-16-15-25-24-13-10-21(34)17-19(24)7-12-26(25)27(29)14-9-20(29)8-11-23(18-28(35)30(31,32)33)38(36,37)22-5-3-2-4-6-22;2*1-2/h2-7,20-21,23-28,34-35H,8-18H2,1H3;2*1-2H3/t20-,21?,23?,24?,25?,26?,27?,28?,29?;;/m0../s1 |
| InChIKey | NXMCDJHODCJOLF-JFJMGLLLSA-N |
| XLogP | 8.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.86 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|