About ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole
ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole (PubChem CID 142333133) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole.
Molecular Properties
| Compound Name | ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole |
| PubChem CID | 142333133 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole |
| SMILES | CC.CCc1ccc(-n2cnc(C)n2)cc1 |
| InChI | InChI=1S/C11H13N3.C2H6/c1-3-10-4-6-11(7-5-10)14-8-12-9(2)13-14;1-2/h4-8H,3H2,1-2H3;1-2H3 |
| InChIKey | NLQRNUHNSAACAU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole?
The IUPAC name of ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole (CID 142333133) is ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole.
What is the SMILES notation for ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole?
The canonical SMILES for ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole is CC.CCc1ccc(-n2cnc(C)n2)cc1.
What is the InChIKey of ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole?
The InChIKey is NLQRNUHNSAACAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3.C2H6/c1-3-10-4-6-11(7-5-10)14-8-12-9(2)13-14;1-2/h4-8H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole?
ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole has a molecular weight of 217.32 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(4-ethylphenyl)-3-methyl-1,2,4-triazole is sourced from PubChem (CID 142333133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).