C15H14ClF2IN5PS — CID 142334043
1-N-[5-chloro-2-(difluoromethyl)-3-iodophosphanylimidazo[4,5-b]pyridin-7-yl]-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine (PubChem CID 142334043) has the molecular formula C15H14ClF2IN5PS and a molecular weight of 527.71 g/mol. Its IUPAC name is 1-N-[5-chloro-2-(difluoromethyl)-3-iodophosphanylimidazo[4,5-b]pyridin-7-yl]-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine.
| Compound Name | 1-N-[5-chloro-2-(difluoromethyl)-3-iodophosphanylimidazo[4,5-b]pyridin-7-yl]-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 142334043 |
| Molecular Formula | C15H14ClF2IN5PS |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 526.94 |
| IUPAC Name | 1-N-[5-chloro-2-(difluoromethyl)-3-iodophosphanylimidazo[4,5-b]pyridin-7-yl]-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine |
| SMILES | CSN(C)c1ccccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2PI |
| InChI | InChI=1S/C15H14ClF2IN5PS/c1-23(26-2)10-6-4-3-5-8(10)20-9-7-11(16)21-14-12(9)22-15(13(17)18)24(14)25-19/h3-7,13,25H,1-2H3,(H,20,21) |
| InChIKey | JTPAXEQWZSJNSC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|