About 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline
4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline (PubChem CID 142334200) has the molecular formula C12H15F2NOS
and a molecular weight of 259.32 g/mol. Its IUPAC name is 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline.
Molecular Properties
| Compound Name | 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline |
| PubChem CID | 142334200 |
| Molecular Formula | C12H15F2NOS |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline |
| SMILES | CSc1cc(C2CCC(F)(F)CO2)ccc1N |
| InChI | InChI=1S/C12H15F2NOS/c1-17-11-6-8(2-3-9(11)15)10-4-5-12(13,14)7-16-10/h2-3,6,10H,4-5,7,15H2,1H3 |
| InChIKey | DWOPTOFUFMLVPX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline?
The IUPAC name of 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline (CID 142334200) is 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline.
What is the SMILES notation for 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline?
The canonical SMILES for 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline is CSc1cc(C2CCC(F)(F)CO2)ccc1N.
What is the InChIKey of 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline?
The InChIKey is DWOPTOFUFMLVPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2NOS/c1-17-11-6-8(2-3-9(11)15)10-4-5-12(13,14)7-16-10/h2-3,6,10H,4-5,7,15H2,1H3.
What are the key properties of 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline?
4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline has a molecular weight of 259.32 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5,5-difluorooxan-2-yl)-2-methylsulfanylaniline is sourced from PubChem (CID 142334200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).