About 2-amino-5-phenoxybenzoic acid
2-amino-5-phenoxybenzoic acid (PubChem CID 14233437) has the molecular formula C13H11NO3
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-amino-5-phenoxybenzoic acid.
Molecular Properties
| Compound Name | 2-amino-5-phenoxybenzoic acid |
| PubChem CID | 14233437 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-amino-5-phenoxybenzoic acid |
| SMILES | Nc1ccc(Oc2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C13H11NO3/c14-12-7-6-10(8-11(12)13(15)16)17-9-4-2-1-3-5-9/h1-8H,14H2,(H,15,16) |
| InChIKey | DQQGVGXQQYLHTC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-phenoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-phenoxybenzoic acid?
The IUPAC name of 2-amino-5-phenoxybenzoic acid (CID 14233437) is 2-amino-5-phenoxybenzoic acid.
What is the SMILES notation for 2-amino-5-phenoxybenzoic acid?
The canonical SMILES for 2-amino-5-phenoxybenzoic acid is Nc1ccc(Oc2ccccc2)cc1C(=O)O.
What is the InChIKey of 2-amino-5-phenoxybenzoic acid?
The InChIKey is DQQGVGXQQYLHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO3/c14-12-7-6-10(8-11(12)13(15)16)17-9-4-2-1-3-5-9/h1-8H,14H2,(H,15,16).
What are the key properties of 2-amino-5-phenoxybenzoic acid?
2-amino-5-phenoxybenzoic acid has a molecular weight of 229.24 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-phenoxybenzoic acid is sourced from PubChem (CID 14233437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).