C20H22ClIN7PS — CID 142334386
1-N-(5-chloro-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl)-4-(1,5-dimethylimidazol-2-yl)-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine (PubChem CID 142334386) has the molecular formula C20H22ClIN7PS and a molecular weight of 585.84 g/mol. Its IUPAC name is 1-N-(5-chloro-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl)-4-(1,5-dimethylimidazol-2-yl)-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine.
| Compound Name | 1-N-(5-chloro-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl)-4-(1,5-dimethylimidazol-2-yl)-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 142334386 |
| Molecular Formula | C20H22ClIN7PS |
| Molecular Weight | 585.84 g/mol |
| Exact Mass | 585.01 |
| IUPAC Name | 1-N-(5-chloro-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-yl)-4-(1,5-dimethylimidazol-2-yl)-2-N-methyl-2-N-methylsulfanylbenzene-1,2-diamine |
| SMILES | CSN(C)c1cc(-c2ncc(C)n2C)ccc1Nc1cc(Cl)nc2c1nc(C)n2PI |
| InChI | InChI=1S/C20H22ClIN7PS/c1-11-10-23-19(27(11)3)13-6-7-14(16(8-13)28(4)31-5)25-15-9-17(21)26-20-18(15)24-12(2)29(20)30-22/h6-10,30H,1-5H3,(H,25,26) |
| InChIKey | GUPHEHUEKYGMCO-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 63.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.84 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|