C12H11ClF2IN4P — CID 142334410
5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[(2E)-penta-2,4-dien-2-yl]imidazo[4,5-b]pyridin-7-amine (PubChem CID 142334410) has the molecular formula C12H11ClF2IN4P and a molecular weight of 442.58 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[(2E)-penta-2,4-dien-2-yl]imidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[(2E)-penta-2,4-dien-2-yl]imidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 142334410 |
| Molecular Formula | C12H11ClF2IN4P |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 441.94 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-3-iodophosphanyl-N-[(2E)-penta-2,4-dien-2-yl]imidazo[4,5-b]pyridin-7-amine |
| SMILES | C=C/C=C(\C)Nc1cc(Cl)nc2c1nc(C(F)F)n2PI |
| InChI | InChI=1S/C12H11ClF2IN4P/c1-3-4-6(2)17-7-5-8(13)18-11-9(7)19-12(10(14)15)20(11)21-16/h3-5,10,21H,1H2,2H3,(H,17,18)/b6-4+ |
| InChIKey | GJBCVGQVWZYYOY-GQCTYLIASA-N |
| XLogP | 5.32 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|