C21H16F2IN6PS — CID 142334470
2-(difluoromethyl)-5-N-(6-ethynyl-2-pyridinyl)-3-iodophosphanyl-7-N-(2-methylsulfanylphenyl)imidazo[4,5-b]pyridine-5,7-diamine (PubChem CID 142334470) has the molecular formula C21H16F2IN6PS and a molecular weight of 580.34 g/mol. Its IUPAC name is 2-(difluoromethyl)-5-N-(6-ethynyl-2-pyridinyl)-3-iodophosphanyl-7-N-(2-methylsulfanylphenyl)imidazo[4,5-b]pyridine-5,7-diamine.
| Compound Name | 2-(difluoromethyl)-5-N-(6-ethynyl-2-pyridinyl)-3-iodophosphanyl-7-N-(2-methylsulfanylphenyl)imidazo[4,5-b]pyridine-5,7-diamine |
|---|---|
| PubChem CID | 142334470 |
| Molecular Formula | C21H16F2IN6PS |
| Molecular Weight | 580.34 g/mol |
| Exact Mass | 579.99 |
| IUPAC Name | 2-(difluoromethyl)-5-N-(6-ethynyl-2-pyridinyl)-3-iodophosphanyl-7-N-(2-methylsulfanylphenyl)imidazo[4,5-b]pyridine-5,7-diamine |
| SMILES | C#Cc1cccc(Nc2cc(Nc3ccccc3SC)c3nc(C(F)F)n(PI)c3n2)n1 |
| InChI | InChI=1S/C21H16F2IN6PS/c1-3-12-7-6-10-16(25-12)27-17-11-14(26-13-8-4-5-9-15(13)32-2)18-20(28-17)30(31-24)21(29-18)19(22)23/h1,4-11,19,31H,2H3,(H2,25,26,27,28) |
| InChIKey | OQOLVOOJCQBOPF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.34 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|