C19H18ClF2IN5OPS — CID 142334567
5-chloro-2-(difluoromethyl)-N-[4-(5,5-dimethyl-4H-1,3-oxazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine (PubChem CID 142334567) has the molecular formula C19H18ClF2IN5OPS and a molecular weight of 595.78 g/mol. Its IUPAC name is 5-chloro-2-(difluoromethyl)-N-[4-(5,5-dimethyl-4H-1,3-oxazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine.
| Compound Name | 5-chloro-2-(difluoromethyl)-N-[4-(5,5-dimethyl-4H-1,3-oxazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine |
|---|---|
| PubChem CID | 142334567 |
| Molecular Formula | C19H18ClF2IN5OPS |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 594.97 |
| IUPAC Name | 5-chloro-2-(difluoromethyl)-N-[4-(5,5-dimethyl-4H-1,3-oxazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanylimidazo[4,5-b]pyridin-7-amine |
| SMILES | CSc1cc(C2=NCC(C)(C)O2)ccc1Nc1cc(Cl)nc2c1nc(C(F)F)n2PI |
| InChI | InChI=1S/C19H18ClF2IN5OPS/c1-19(2)8-24-18(29-19)9-4-5-10(12(6-9)31-3)25-11-7-13(20)26-16-14(11)27-17(15(21)22)28(16)30-23/h4-7,15,30H,8H2,1-3H3,(H,25,26) |
| InChIKey | CNXFYFLIQCCBOH-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|