C21H23ClIN8PS — CID 142334790
7-N-[4-chloro-2-[methyl(methylsulfanyl)amino]phenyl]-5-N-(5,6-dimethylpyrazin-2-yl)-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridine-5,7-diamine (PubChem CID 142334790) has the molecular formula C21H23ClIN8PS and a molecular weight of 612.87 g/mol. Its IUPAC name is 7-N-[4-chloro-2-[methyl(methylsulfanyl)amino]phenyl]-5-N-(5,6-dimethylpyrazin-2-yl)-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridine-5,7-diamine.
| Compound Name | 7-N-[4-chloro-2-[methyl(methylsulfanyl)amino]phenyl]-5-N-(5,6-dimethylpyrazin-2-yl)-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridine-5,7-diamine |
|---|---|
| PubChem CID | 142334790 |
| Molecular Formula | C21H23ClIN8PS |
| Molecular Weight | 612.87 g/mol |
| Exact Mass | 612.02 |
| IUPAC Name | 7-N-[4-chloro-2-[methyl(methylsulfanyl)amino]phenyl]-5-N-(5,6-dimethylpyrazin-2-yl)-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridine-5,7-diamine |
| SMILES | CSN(C)c1cc(Cl)ccc1Nc1cc(Nc2cnc(C)c(C)n2)nc2c1nc(C)n2PI |
| InChI | InChI=1S/C21H23ClIN8PS/c1-11-12(2)25-19(10-24-11)28-18-9-16(20-21(29-18)31(32-23)13(3)26-20)27-15-7-6-14(22)8-17(15)30(4)33-5/h6-10,32H,1-5H3,(H2,25,27,28,29) |
| InChIKey | PIBNEFHCIXGJPS-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.87 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|