C25H31N11O — CID 142334881
N'-[amino(methyl)amino]-3-[[5-[(6-cyano-5-propan-2-yl-2-pyridinyl)amino]-2-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzenecarboximidamide (PubChem CID 142334881) has the molecular formula C25H31N11O and a molecular weight of 501.60 g/mol. Its IUPAC name is N'-[amino(methyl)amino]-3-[[5-[(6-cyano-5-propan-2-yl-2-pyridinyl)amino]-2-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzenecarboximidamide.
| Compound Name | N'-[amino(methyl)amino]-3-[[5-[(6-cyano-5-propan-2-yl-2-pyridinyl)amino]-2-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 142334881 |
| Molecular Formula | C25H31N11O |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | N'-[amino(methyl)amino]-3-[[5-[(6-cyano-5-propan-2-yl-2-pyridinyl)amino]-2-methyl-2,3-dihydro-1H-imidazo[4,5-b]pyridin-7-yl]amino]-2-methoxybenzenecarboximidamide |
| SMILES | COc1c(Nc2cc(Nc3ccc(C(C)C)c(C#N)n3)nc3c2NC(C)N3)cccc1/C(N)=N/N(C)N |
| InChI | InChI=1S/C25H31N11O/c1-13(2)15-9-10-20(32-19(15)12-26)33-21-11-18(22-25(34-21)30-14(3)29-22)31-17-8-6-7-16(23(17)37-5)24(27)35-36(4)28/h6-11,13-14,29H,28H2,1-5H3,(H2,27,35)(H3,30,31,32,33,34) |
| InChIKey | ZWMMBLUQWWDHLS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 174.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|