C21H26ClIN5PS2 — CID 142334913
5-chloro-N-[4-(4,4-dimethyl-5H-1,3-thiazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-amine;ethane (PubChem CID 142334913) has the molecular formula C21H26ClIN5PS2 and a molecular weight of 605.94 g/mol. Its IUPAC name is 5-chloro-N-[4-(4,4-dimethyl-5H-1,3-thiazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-amine;ethane.
| Compound Name | 5-chloro-N-[4-(4,4-dimethyl-5H-1,3-thiazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-amine;ethane |
|---|---|
| PubChem CID | 142334913 |
| Molecular Formula | C21H26ClIN5PS2 |
| Molecular Weight | 605.94 g/mol |
| Exact Mass | 605.01 |
| IUPAC Name | 5-chloro-N-[4-(4,4-dimethyl-5H-1,3-thiazol-2-yl)-2-methylsulfanylphenyl]-3-iodophosphanyl-2-methylimidazo[4,5-b]pyridin-7-amine;ethane |
| SMILES | CC.CSc1cc(C2=NC(C)(C)CS2)ccc1Nc1cc(Cl)nc2c1nc(C)n2PI |
| InChI | InChI=1S/C19H20ClIN5PS2.C2H6/c1-10-22-16-13(8-15(20)24-17(16)26(10)27-21)23-12-6-5-11(7-14(12)28-4)18-25-19(2,3)9-29-18;1-2/h5-8,27H,9H2,1-4H3,(H,23,24);1-2H3 |
| InChIKey | LJDHSXUPCJNBBF-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.94 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|