About 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline
3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline (PubChem CID 1423358) has the molecular formula C23H21N5O2
and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline.
Molecular Properties
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline |
| PubChem CID | 1423358 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3nc4ccccc4nc3n2CCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C23H21N5O2/c29-28(30)18-12-10-17(11-13-18)22-26-21-23(25-20-9-5-4-8-19(20)24-21)27(22)15-14-16-6-2-1-3-7-16/h4-6,8-13H,1-3,7,14-15H2 |
| InChIKey | WBAONQJDHLQVPC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline?
The IUPAC name of 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline (CID 1423358) is 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline.
What is the SMILES notation for 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline?
The canonical SMILES for 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline is O=[N+]([O-])c1ccc(-c2nc3nc4ccccc4nc3n2CCC2=CCCCC2)cc1.
What is the InChIKey of 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline?
The InChIKey is WBAONQJDHLQVPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N5O2/c29-28(30)18-12-10-17(11-13-18)22-26-21-23(25-20-9-5-4-8-19(20)24-21)27(22)15-14-16-6-2-1-3-7-16/h4-6,8-13H,1-3,7,14-15H2.
What are the key properties of 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline?
3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline has a molecular weight of 399.45 g/mol, XLogP of 5.45, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(cyclohexen-1-yl)ethyl]-2-(4-nitrophenyl)imidazo[4,5-b]quinoxaline is sourced from PubChem (CID 1423358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).