About 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one
3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one (PubChem CID 142335812) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one |
| PubChem CID | 142335812 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one |
| SMILES | C=CCn1c(CO)n[nH]c1=O |
| InChI | InChI=1S/C6H9N3O2/c1-2-3-9-5(4-10)7-8-6(9)11/h2,10H,1,3-4H2,(H,8,11) |
| InChIKey | OXKSBQMRAGLQRY-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one?
The IUPAC name of 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one (CID 142335812) is 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one is C=CCn1c(CO)n[nH]c1=O.
What is the InChIKey of 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one?
The InChIKey is OXKSBQMRAGLQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-2-3-9-5(4-10)7-8-6(9)11/h2,10H,1,3-4H2,(H,8,11).
What are the key properties of 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one?
3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one has a molecular weight of 155.16 g/mol, XLogP of -0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-4-prop-2-enyl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 142335812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).