C50H24F6N4O2 — CID 142336427
8-[5-(3,4,5-trifluorophenyl)-2-pyridinyl]-4-[4-[8-[5-(3,4,5-trifluorophenyl)-2-pyridinyl]-[1]benzofuro[3,2-b]pyridin-4-yl]phenyl]-[1]benzofuro[3,2-b]pyridine (PubChem CID 142336427) has the molecular formula C50H24F6N4O2 and a molecular weight of 826.76 g/mol. Its IUPAC name is 8-[5-(3,4,5-trifluorophenyl)-2-pyridinyl]-4-[4-[8-[5-(3,4,5-trifluorophenyl)-2-pyridinyl]-[1]benzofuro[3,2-b]pyridin-4-yl]phenyl]-[1]benzofuro[3,2-b]pyridine.
| Compound Name | 8-[5-(3,4,5-trifluorophenyl)-2-pyridinyl]-4-[4-[8-[5-(3,4,5-trifluorophenyl)-2-pyridinyl]-[1]benzofuro[3,2-b]pyridin-4-yl]phenyl]-[1]benzofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 142336427 |
| Molecular Formula | C50H24F6N4O2 |
| Molecular Weight | 826.76 g/mol |
| Exact Mass | 826.18 |
| IUPAC Name | 8-[5-(3,4,5-trifluorophenyl)-2-pyridinyl]-4-[4-[8-[5-(3,4,5-trifluorophenyl)-2-pyridinyl]-[1]benzofuro[3,2-b]pyridin-4-yl]phenyl]-[1]benzofuro[3,2-b]pyridine |
| SMILES | Fc1cc(-c2ccc(-c3ccc4oc5c(-c6ccc(-c7ccnc8c7oc7ccc(-c9ccc(-c%10cc(F)c(F)c(F)c%10)cn9)cc78)cc6)ccnc5c4c3)nc2)cc(F)c1F |
| InChI | InChI=1S/C50H24F6N4O2/c51-37-19-31(20-38(52)45(37)55)29-5-9-41(59-23-29)27-7-11-43-35(17-27)47-49(61-43)33(13-15-57-47)25-1-2-26(4-3-25)34-14-16-58-48-36-18-28(8-12-44(36)62-50(34)48)42-10-6-30(24-60-42)32-21-39(53)46(56)40(54)22-32/h1-24H |
| InChIKey | SKYRZMUSZLYIOG-UHFFFAOYSA-N |
| XLogP | 13.90 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.76 |
| LogP ≤ 5 | 13.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|