About (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide
(E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide (PubChem CID 142336950) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide.
Molecular Properties
| Compound Name | (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide |
| PubChem CID | 142336950 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide |
| SMILES | C/C=C\N=C(N)\C=C(/C)CC |
| InChI | InChI=1S/C9H16N2/c1-4-6-11-9(10)7-8(3)5-2/h4,6-7H,5H2,1-3H3,(H2,10,11)/b6-4-,8-7+ |
| InChIKey | MKSRCPJUAZWSHT-IQTBQJLQSA-N |
| XLogP | 2.23 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide?
The IUPAC name of (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide (CID 142336950) is (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide.
What is the SMILES notation for (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide?
The canonical SMILES for (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide is C/C=C\N=C(N)\C=C(/C)CC.
What is the InChIKey of (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide?
The InChIKey is MKSRCPJUAZWSHT-IQTBQJLQSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-6-11-9(10)7-8(3)5-2/h4,6-7H,5H2,1-3H3,(H2,10,11)/b6-4-,8-7+.
What are the key properties of (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide?
(E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide has a molecular weight of 152.24 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methyl-N'-[(Z)-prop-1-enyl]pent-2-enimidamide is sourced from PubChem (CID 142336950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).