C17H23N5O — CID 142336989
1-[6-[(1-ethenyl-2-methyl-2H-pyridin-4-yl)amino]-2-methylpyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 142336989) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 1-[6-[(1-ethenyl-2-methyl-2H-pyridin-4-yl)amino]-2-methylpyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | 1-[6-[(1-ethenyl-2-methyl-2H-pyridin-4-yl)amino]-2-methylpyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 142336989 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-[6-[(1-ethenyl-2-methyl-2H-pyridin-4-yl)amino]-2-methylpyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | C=CN1C=CC(Nc2cc(N3CCC(O)C3)nc(C)n2)=CC1C |
| InChI | InChI=1S/C17H23N5O/c1-4-21-7-5-14(9-12(21)2)20-16-10-17(19-13(3)18-16)22-8-6-15(23)11-22/h4-5,7,9-10,12,15,23H,1,6,8,11H2,2-3H3,(H,18,19,20) |
| InChIKey | ZHINFWHRBSNYIJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |