C15H20FNO — CID 142337386
(10bR)-9-fluoro-3-(2-methoxyethyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline (PubChem CID 142337386) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is (10bR)-9-fluoro-3-(2-methoxyethyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline.
| Compound Name | (10bR)-9-fluoro-3-(2-methoxyethyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 142337386 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (10bR)-9-fluoro-3-(2-methoxyethyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
| SMILES | COCCC1CC[C@@H]2c3cc(F)ccc3CCN12 |
| InChI | InChI=1S/C15H20FNO/c1-18-9-7-13-4-5-15-14-10-12(16)3-2-11(14)6-8-17(13)15/h2-3,10,13,15H,4-9H2,1H3/t13?,15-/m1/s1 |
| InChIKey | CWCBVOOBEMLMKY-AWKYBWMHSA-N |
| XLogP | 2.92 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |