C28H27Br2F3N2O2S2 — CID 142337416
N-[2-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]-4-bromo-N-(4-bromophenyl)sulfinylbenzenesulfinamide (PubChem CID 142337416) has the molecular formula C28H27Br2F3N2O2S2 and a molecular weight of 704.47 g/mol. Its IUPAC name is N-[2-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]-4-bromo-N-(4-bromophenyl)sulfinylbenzenesulfinamide.
| Compound Name | N-[2-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]-4-bromo-N-(4-bromophenyl)sulfinylbenzenesulfinamide |
|---|---|
| PubChem CID | 142337416 |
| Molecular Formula | C28H27Br2F3N2O2S2 |
| Molecular Weight | 704.47 g/mol |
| Exact Mass | 701.98 |
| IUPAC Name | N-[2-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]-4-bromo-N-(4-bromophenyl)sulfinylbenzenesulfinamide |
| SMILES | O=S(c1ccc(Br)cc1)N(c1cc(C(F)(F)F)ccc1N1CC[C@@H]2CCCCC2C1)S(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C28H27Br2F3N2O2S2/c29-22-6-10-24(11-7-22)38(36)35(39(37)25-12-8-23(30)9-13-25)27-17-21(28(31,32)33)5-14-26(27)34-16-15-19-3-1-2-4-20(19)18-34/h5-14,17,19-20H,1-4,15-16,18H2/t19-,20?,38?,39?/m0/s1 |
| InChIKey | LFKVERZWDDVGMF-LCNVYWHSSA-N |
| XLogP | 8.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.47 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |