C31H33N3O5 — CID 142337903
methanol;N-[[3-(2-methoxyethoxy)phenyl]methyl]-3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzamide (PubChem CID 142337903) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is methanol;N-[[3-(2-methoxyethoxy)phenyl]methyl]-3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzamide.
| Compound Name | methanol;N-[[3-(2-methoxyethoxy)phenyl]methyl]-3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 142337903 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | methanol;N-[[3-(2-methoxyethoxy)phenyl]methyl]-3-[[(4-pyridin-4-ylbenzoyl)amino]methyl]benzamide |
| SMILES | CO.COCCOc1cccc(CNC(=O)c2cccc(CNC(=O)c3ccc(-c4ccncc4)cc3)c2)c1 |
| InChI | InChI=1S/C30H29N3O4.CH4O/c1-36-16-17-37-28-7-3-5-23(19-28)21-33-30(35)27-6-2-4-22(18-27)20-32-29(34)26-10-8-24(9-11-26)25-12-14-31-15-13-25;1-2/h2-15,18-19H,16-17,20-21H2,1H3,(H,32,34)(H,33,35);2H,1H3 |
| InChIKey | PFAYSQCLVOJICC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|