About ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine
ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine (PubChem CID 142338088) has the molecular formula C11H24FN
and a molecular weight of 189.32 g/mol. Its IUPAC name is ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 142338088 |
| Molecular Formula | C11H24FN |
| Molecular Weight | 189.32 g/mol |
| Exact Mass | 189.19 |
| IUPAC Name | ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine |
| SMILES | CC.CC.CC1CCN(C)C=C1F |
| InChI | InChI=1S/C7H12FN.2C2H6/c1-6-3-4-9(2)5-7(6)8;2*1-2/h5-6H,3-4H2,1-2H3;2*1-2H3 |
| InChIKey | STPLFAKBDHLESL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine?
The IUPAC name of ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine (CID 142338088) is ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine is CC.CC.CC1CCN(C)C=C1F.
What is the InChIKey of ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine?
The InChIKey is STPLFAKBDHLESL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12FN.2C2H6/c1-6-3-4-9(2)5-7(6)8;2*1-2/h5-6H,3-4H2,1-2H3;2*1-2H3.
What are the key properties of ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine?
ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine has a molecular weight of 189.32 g/mol, XLogP of 3.82, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-1,4-dimethyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 142338088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).