About 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine
1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine (PubChem CID 142338398) has the molecular formula C8H13N5
and a molecular weight of 179.23 g/mol. Its IUPAC name is 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine.
Molecular Properties
| Compound Name | 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine |
| PubChem CID | 142338398 |
| Molecular Formula | C8H13N5 |
| Molecular Weight | 179.23 g/mol |
| Exact Mass | 179.12 |
| IUPAC Name | 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine |
| SMILES | [H]/N=N/N(C)C(N)c1cccc(N)c1 |
| InChI | InChI=1S/C8H13N5/c1-13(12-11)8(10)6-3-2-4-7(9)5-6/h2-5,8,11H,9-10H2,1H3/b12-11+ |
| InChIKey | DVSNEEIEZLXHQY-VAWYXSNFSA-N |
| XLogP | 1.10 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine?
The IUPAC name of 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine (CID 142338398) is 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine.
What is the SMILES notation for 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine?
The canonical SMILES for 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine is [H]/N=N/N(C)C(N)c1cccc(N)c1.
What is the InChIKey of 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine?
The InChIKey is DVSNEEIEZLXHQY-VAWYXSNFSA-N. The full InChI is InChI=1S/C8H13N5/c1-13(12-11)8(10)6-3-2-4-7(9)5-6/h2-5,8,11H,9-10H2,1H3/b12-11+.
What are the key properties of 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine?
1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine has a molecular weight of 179.23 g/mol, XLogP of 1.10, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminophenyl)-N'-diazenyl-N'-methylmethanediamine is sourced from PubChem (CID 142338398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).