About 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole
4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole (PubChem CID 142338406) has the molecular formula C9H7F4N
and a molecular weight of 205.15 g/mol. Its IUPAC name is 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole |
| PubChem CID | 142338406 |
| Molecular Formula | C9H7F4N |
| Molecular Weight | 205.15 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole |
| SMILES | Fc1c(C(F)(F)F)ccc2c1CNC2 |
| InChI | InChI=1S/C9H7F4N/c10-8-6-4-14-3-5(6)1-2-7(8)9(11,12)13/h1-2,14H,3-4H2 |
| InChIKey | ZXXBSJGNXJEOAS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.15 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole?
The IUPAC name of 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole (CID 142338406) is 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole?
The canonical SMILES for 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole is Fc1c(C(F)(F)F)ccc2c1CNC2.
What is the InChIKey of 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole?
The InChIKey is ZXXBSJGNXJEOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F4N/c10-8-6-4-14-3-5(6)1-2-7(8)9(11,12)13/h1-2,14H,3-4H2.
What are the key properties of 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole?
4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole has a molecular weight of 205.15 g/mol, XLogP of 2.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5-(trifluoromethyl)-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 142338406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).