C17H30N2O7 — CID 142338820
2-[2-(2-acetamidoethoxy)ethoxy]-N-[2-[2-(3-methyl-2-oxobut-3-enoxy)ethoxy]ethyl]acetamide (PubChem CID 142338820) has the molecular formula C17H30N2O7 and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-[2-(2-acetamidoethoxy)ethoxy]-N-[2-[2-(3-methyl-2-oxobut-3-enoxy)ethoxy]ethyl]acetamide.
| Compound Name | 2-[2-(2-acetamidoethoxy)ethoxy]-N-[2-[2-(3-methyl-2-oxobut-3-enoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 142338820 |
| Molecular Formula | C17H30N2O7 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 2-[2-(2-acetamidoethoxy)ethoxy]-N-[2-[2-(3-methyl-2-oxobut-3-enoxy)ethoxy]ethyl]acetamide |
| SMILES | C=C(C)C(=O)COCCOCCNC(=O)COCCOCCNC(C)=O |
| InChI | InChI=1S/C17H30N2O7/c1-14(2)16(21)12-25-10-8-24-7-5-19-17(22)13-26-11-9-23-6-4-18-15(3)20/h1,4-13H2,2-3H3,(H,18,20)(H,19,22) |
| InChIKey | ATMGWEUHGHUFBC-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|