About 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol
5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol (PubChem CID 142338987) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol.
Molecular Properties
| Compound Name | 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol |
| PubChem CID | 142338987 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol |
| SMILES | C#CNCCC1C=CC(O)=C(O)C1 |
| InChI | InChI=1S/C10H13NO2/c1-2-11-6-5-8-3-4-9(12)10(13)7-8/h1,3-4,8,11-13H,5-7H2 |
| InChIKey | HUDJCYFDMXTYOU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol?
The IUPAC name of 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol (CID 142338987) is 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol.
What is the SMILES notation for 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol?
The canonical SMILES for 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol is C#CNCCC1C=CC(O)=C(O)C1.
What is the InChIKey of 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol?
The InChIKey is HUDJCYFDMXTYOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-2-11-6-5-8-3-4-9(12)10(13)7-8/h1,3-4,8,11-13H,5-7H2.
What are the key properties of 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol?
5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol has a molecular weight of 179.22 g/mol, XLogP of 1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(ethynylamino)ethyl]cyclohexa-1,3-diene-1,2-diol is sourced from PubChem (CID 142338987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).