About N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen
N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen (PubChem CID 142339341) has the molecular formula C17H35N3O
and a molecular weight of 297.49 g/mol. Its IUPAC name is N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen.
Molecular Properties
| Compound Name | N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen |
| PubChem CID | 142339341 |
| Molecular Formula | C17H35N3O |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen |
| SMILES | CCCC(CC)N/C(=N\C1CCCCC1)N1CCOCC1.[H][H] |
| InChI | InChI=1S/C17H33N3O.H2/c1-3-8-15(4-2)18-17(20-11-13-21-14-12-20)19-16-9-6-5-7-10-16;/h15-16H,3-14H2,1-2H3,(H,18,19);1H |
| InChIKey | UGDUQWOIUQUTOC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen?
The IUPAC name of N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen (CID 142339341) is N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen.
What is the SMILES notation for N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen?
The canonical SMILES for N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen is CCCC(CC)N/C(=N\C1CCCCC1)N1CCOCC1.[H][H].
What is the InChIKey of N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen?
The InChIKey is UGDUQWOIUQUTOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33N3O.H2/c1-3-8-15(4-2)18-17(20-11-13-21-14-12-20)19-16-9-6-5-7-10-16;/h15-16H,3-14H2,1-2H3,(H,18,19);1H.
What are the key properties of N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen?
N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen has a molecular weight of 297.49 g/mol, XLogP of 3.42, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclohexyl-N-hexan-3-ylmorpholine-4-carboximidamide;molecular hydrogen is sourced from PubChem (CID 142339341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).