C35H37N5O10 — CID 142339397
2-hydroxyethyl 3-[2-[[4-[N-(1-acetyloxyethoxycarbonyl)carbamimidoyl]phenyl]carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate (PubChem CID 142339397) has the molecular formula C35H37N5O10 and a molecular weight of 687.71 g/mol. Its IUPAC name is 2-hydroxyethyl 3-[2-[[4-[N-(1-acetyloxyethoxycarbonyl)carbamimidoyl]phenyl]carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate.
| Compound Name | 2-hydroxyethyl 3-[2-[[4-[N-(1-acetyloxyethoxycarbonyl)carbamimidoyl]phenyl]carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 142339397 |
| Molecular Formula | C35H37N5O10 |
| Molecular Weight | 687.71 g/mol |
| Exact Mass | 687.25 |
| IUPAC Name | 2-hydroxyethyl 3-[2-[[4-[N-(1-acetyloxyethoxycarbonyl)carbamimidoyl]phenyl]carbamoyl]-4-ethenyl-5-methoxyphenyl]-6-(cyclopropylmethylcarbamoyl)pyridine-2-carboxylate |
| SMILES | [H]/N=C(\NC(=O)OC(C)OC(C)=O)c1ccc(NC(=O)c2cc(C=C)c(OC)cc2-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCCO)cc1 |
| InChI | InChI=1S/C35H37N5O10/c1-5-22-16-27(32(43)38-24-10-8-23(9-11-24)31(36)40-35(46)50-20(3)49-19(2)42)26(17-29(22)47-4)25-12-13-28(33(44)37-18-21-6-7-21)39-30(25)34(45)48-15-14-41/h5,8-13,16-17,20-21,41H,1,6-7,14-15,18H2,2-4H3,(H,37,44)(H,38,43)(H2,36,40,46) |
| InChIKey | VTJAHVFSXJXNCQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 215.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|