C32H31FN4O7 — CID 142339414
2-formyloxyethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-[(E)-N-fluoro-C-methylcarbonimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate (PubChem CID 142339414) has the molecular formula C32H31FN4O7 and a molecular weight of 602.62 g/mol. Its IUPAC name is 2-formyloxyethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-[(E)-N-fluoro-C-methylcarbonimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate.
| Compound Name | 2-formyloxyethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-[(E)-N-fluoro-C-methylcarbonimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 142339414 |
| Molecular Formula | C32H31FN4O7 |
| Molecular Weight | 602.62 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | 2-formyloxyethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[[4-[(E)-N-fluoro-C-methylcarbonimidoyl]phenyl]carbamoyl]-5-methoxyphenyl]pyridine-2-carboxylate |
| SMILES | C=Cc1cc(C(=O)Nc2ccc(/C(C)=N/F)cc2)c(-c2ccc(C(=O)NCC3CC3)nc2C(=O)OCCOC=O)cc1OC |
| InChI | InChI=1S/C32H31FN4O7/c1-4-21-15-26(30(39)35-23-9-7-22(8-10-23)19(2)37-33)25(16-28(21)42-3)24-11-12-27(31(40)34-17-20-5-6-20)36-29(24)32(41)44-14-13-43-18-38/h4,7-12,15-16,18,20H,1,5-6,13-14,17H2,2-3H3,(H,34,40)(H,35,39)/b37-19+ |
| InChIKey | YVUGNKJWZDJERX-SAEPALGJSA-N |
| XLogP | 4.82 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.62 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|