About 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine]
6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] (PubChem CID 142339893) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine].
Molecular Properties
| Compound Name | 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] |
| PubChem CID | 142339893 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] |
| SMILES | CC(C)c1ccc2c(c1)COC21CNC1 |
| InChI | InChI=1S/C13H17NO/c1-9(2)10-3-4-12-11(5-10)6-15-13(12)7-14-8-13/h3-5,9,14H,6-8H2,1-2H3 |
| InChIKey | CWTNGTIOKLJENP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine]?
The IUPAC name of 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] (CID 142339893) is 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine].
What is the SMILES notation for 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine]?
The canonical SMILES for 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] is CC(C)c1ccc2c(c1)COC21CNC1.
What is the InChIKey of 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine]?
The InChIKey is CWTNGTIOKLJENP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-9(2)10-3-4-12-11(5-10)6-15-13(12)7-14-8-13/h3-5,9,14H,6-8H2,1-2H3.
What are the key properties of 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine]?
6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] has a molecular weight of 203.28 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-ylspiro[1H-2-benzofuran-3,3'-azetidine] is sourced from PubChem (CID 142339893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).