C16H25N3 — CID 142340334
1-cyclobutyl-5-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]imidazole;methanamine (PubChem CID 142340334) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-cyclobutyl-5-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]imidazole;methanamine.
| Compound Name | 1-cyclobutyl-5-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]imidazole;methanamine |
|---|---|
| PubChem CID | 142340334 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-cyclobutyl-5-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]imidazole;methanamine |
| SMILES | C=C(/C(C)=C\C=C/C)c1cncn1C1CCC1.CN |
| InChI | InChI=1S/C15H20N2.CH5N/c1-4-5-7-12(2)13(3)15-10-16-11-17(15)14-8-6-9-14;1-2/h4-5,7,10-11,14H,3,6,8-9H2,1-2H3;2H2,1H3/b5-4-,12-7-; |
| InChIKey | BLAVYTKLKCRYEC-GZKSZVSCSA-N |
| XLogP | 3.72 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|