C19H21N — CID 142340608
4-cyclohexa-1,5-dien-1-yl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]aniline (PubChem CID 142340608) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]aniline.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]aniline |
|---|---|
| PubChem CID | 142340608 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]aniline |
| SMILES | C=C/C=C(\C=C/C)Nc1ccc(C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C19H21N/c1-3-8-18(9-4-2)20-19-14-12-17(13-15-19)16-10-6-5-7-11-16/h3-4,6,8-15,20H,1,5,7H2,2H3/b9-4-,18-8+ |
| InChIKey | NWSSXNMUEJYCGD-ZFHQFQHJSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|