About butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin
butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin (PubChem CID 142340805) has the molecular formula C16H33NSSn
and a molecular weight of 390.23 g/mol. Its IUPAC name is butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin.
Molecular Properties
| Compound Name | butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin |
| PubChem CID | 142340805 |
| Molecular Formula | C16H33NSSn |
| Molecular Weight | 390.23 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin |
| SMILES | CCCC.CCCC.CCCC[Sn]c1csc(C)n1 |
| InChI | InChI=1S/C4H4NS.2C4H10.C4H9.Sn/c1-4-5-2-3-6-4;3*1-3-4-2;/h3H,1H3;2*3-4H2,1-2H3;1,3-4H2,2H3; |
| InChIKey | RXCMDWASKBHLNT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.23 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin?
The IUPAC name of butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin (CID 142340805) is butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin.
What is the SMILES notation for butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin?
The canonical SMILES for butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin is CCCC.CCCC.CCCC[Sn]c1csc(C)n1.
What is the InChIKey of butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin?
The InChIKey is RXCMDWASKBHLNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4NS.2C4H10.C4H9.Sn/c1-4-5-2-3-6-4;3*1-3-4-2;/h3H,1H3;2*3-4H2,1-2H3;1,3-4H2,2H3;.
What are the key properties of butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin?
butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin has a molecular weight of 390.23 g/mol, XLogP of 5.61, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;butyl-(2-methyl-1,3-thiazol-4-yl)tin is sourced from PubChem (CID 142340805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).