C14H10F7NO3 — CID 142342206
2,2,2-trifluoro-N-[(3S,4S,5S)-3-(2-fluorophenyl)-4-formyl-5-(trifluoromethyl)oxolan-3-yl]acetamide (PubChem CID 142342206) has the molecular formula C14H10F7NO3 and a molecular weight of 373.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3S,4S,5S)-3-(2-fluorophenyl)-4-formyl-5-(trifluoromethyl)oxolan-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3S,4S,5S)-3-(2-fluorophenyl)-4-formyl-5-(trifluoromethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 142342206 |
| Molecular Formula | C14H10F7NO3 |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3S,4S,5S)-3-(2-fluorophenyl)-4-formyl-5-(trifluoromethyl)oxolan-3-yl]acetamide |
| SMILES | O=C[C@@H]1[C@@H](C(F)(F)F)OC[C@@]1(NC(=O)C(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C14H10F7NO3/c15-9-4-2-1-3-7(9)12(22-11(24)14(19,20)21)6-25-10(8(12)5-23)13(16,17)18/h1-5,8,10H,6H2,(H,22,24)/t8-,10+,12-/m1/s1 |
| InChIKey | DSGDXAUMTSKODR-UBHAPETDSA-N |
| XLogP | 2.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|