About 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde
1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde (PubChem CID 142342367) has the molecular formula C21H23Cl2N3O3
and a molecular weight of 436.34 g/mol. Its IUPAC name is 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde.
Molecular Properties
| Compound Name | 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde |
| PubChem CID | 142342367 |
| Molecular Formula | C21H23Cl2N3O3 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde |
| SMILES | C=O.C=O.CNC(=O)c1cn(-c2ccccc2)c(C)n1.Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H13N3O.C7H6Cl2.2CH2O/c1-9-14-11(12(16)13-2)8-15(9)10-6-4-3-5-7-10;1-5-6(8)3-2-4-7(5)9;2*1-2/h3-8H,1-2H3,(H,13,16);2-4H,1H3;2*1H2 |
| InChIKey | SUMRJEVRGLERKB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde?
The IUPAC name of 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde (CID 142342367) is 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde.
What is the SMILES notation for 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde?
The canonical SMILES for 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde is C=O.C=O.CNC(=O)c1cn(-c2ccccc2)c(C)n1.Cc1c(Cl)cccc1Cl.
What is the InChIKey of 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde?
The InChIKey is SUMRJEVRGLERKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O.C7H6Cl2.2CH2O/c1-9-14-11(12(16)13-2)8-15(9)10-6-4-3-5-7-10;1-5-6(8)3-2-4-7(5)9;2*1-2/h3-8H,1-2H3,(H,13,16);2-4H,1H3;2*1H2.
What are the key properties of 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde?
1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde has a molecular weight of 436.34 g/mol, XLogP of 4.47, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-2-methylbenzene;N,2-dimethyl-1-phenylimidazole-4-carboxamide;formaldehyde is sourced from PubChem (CID 142342367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).