C11H16O5 — CID 142342499
[(5S,7aR)-3,5-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate (PubChem CID 142342499) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is [(5S,7aR)-3,5-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate.
| Compound Name | [(5S,7aR)-3,5-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate |
|---|---|
| PubChem CID | 142342499 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | [(5S,7aR)-3,5-dimethyl-2-oxo-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-6-yl] acetate |
| SMILES | CC(=O)OC1C[C@H]2OC(=O)C(C)C2O[C@H]1C |
| InChI | InChI=1S/C11H16O5/c1-5-10-9(16-11(5)13)4-8(6(2)14-10)15-7(3)12/h5-6,8-10H,4H2,1-3H3/t5?,6-,8?,9+,10?/m0/s1 |
| InChIKey | OBUMHGAQMMIEJL-VNSGFXFVSA-N |
| XLogP | 0.66 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |