C37H27N5O — CID 142343014
2-(6,8-dipyridin-2-yldibenzofuran-1-yl)-4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 142343014) has the molecular formula C37H27N5O and a molecular weight of 557.66 g/mol. Its IUPAC name is 2-(6,8-dipyridin-2-yldibenzofuran-1-yl)-4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 2-(6,8-dipyridin-2-yldibenzofuran-1-yl)-4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 142343014 |
| Molecular Formula | C37H27N5O |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | 2-(6,8-dipyridin-2-yldibenzofuran-1-yl)-4,6-diphenyl-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | c1ccc(C2=NC(c3ccccc3)NC(c3cccc4oc5c(-c6ccccn6)cc(-c6ccccn6)cc5c34)N2)cc1 |
| InChI | InChI=1S/C37H27N5O/c1-3-12-24(13-4-1)35-40-36(25-14-5-2-6-15-25)42-37(41-35)27-16-11-19-32-33(27)29-23-26(30-17-7-9-20-38-30)22-28(34(29)43-32)31-18-8-10-21-39-31/h1-23,35,37,41H,(H,40,42) |
| InChIKey | PCYQVRVVOLWZJH-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |