C51H34N3O- — CID 142343054
2-[6,8-bis(4-phenylphenyl)dibenzofuran-2-yl]-4,6-diphenyl-1,3-diaza-5-azanidacyclohexa-2,6-diene (PubChem CID 142343054) has the molecular formula C51H34N3O- and a molecular weight of 704.85 g/mol. Its IUPAC name is 2-[6,8-bis(4-phenylphenyl)dibenzofuran-2-yl]-4,6-diphenyl-1,3-diaza-5-azanidacyclohexa-2,6-diene.
| Compound Name | 2-[6,8-bis(4-phenylphenyl)dibenzofuran-2-yl]-4,6-diphenyl-1,3-diaza-5-azanidacyclohexa-2,6-diene |
|---|---|
| PubChem CID | 142343054 |
| Molecular Formula | C51H34N3O- |
| Molecular Weight | 704.85 g/mol |
| Exact Mass | 704.27 |
| IUPAC Name | 2-[6,8-bis(4-phenylphenyl)dibenzofuran-2-yl]-4,6-diphenyl-1,3-diaza-5-azanidacyclohexa-2,6-diene |
| SMILES | c1ccc(C2=NC(c3ccc4oc5c(-c6ccc(-c7ccccc7)cc6)cc(-c6ccc(-c7ccccc7)cc6)cc5c4c3)=NC(c3ccccc3)[N-]2)cc1 |
| InChI | InChI=1S/C51H34N3O/c1-5-13-34(14-6-1)36-21-23-38(24-22-36)43-32-44(39-27-25-37(26-28-39)35-15-7-2-8-16-35)48-46(33-43)45-31-42(29-30-47(45)55-48)51-53-49(40-17-9-3-10-18-40)52-50(54-51)41-19-11-4-12-20-41/h1-33,49H/q-1 |
| InChIKey | SFRNRNZCLWDCCM-UHFFFAOYSA-N |
| XLogP | 13.53 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.85 |
| LogP ≤ 5 | 13.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |