About 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid
4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid (PubChem CID 142344094) has the molecular formula C23H18Cl2N2O5
and a molecular weight of 473.31 g/mol. Its IUPAC name is 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid.
Molecular Properties
| Compound Name | 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid |
| PubChem CID | 142344094 |
| Molecular Formula | C23H18Cl2N2O5 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid |
| SMILES | Cc1cccnc1-c1ccc(CC(NC(=O)c2c(Cl)cc(C(=O)O)cc2Cl)C(=O)O)cc1 |
| InChI | InChI=1S/C23H18Cl2N2O5/c1-12-3-2-8-26-20(12)14-6-4-13(5-7-14)9-18(23(31)32)27-21(28)19-16(24)10-15(22(29)30)11-17(19)25/h2-8,10-11,18H,9H2,1H3,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | PHWKFKLXDKWQTP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid?
The IUPAC name of 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid (CID 142344094) is 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid.
What is the SMILES notation for 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid?
The canonical SMILES for 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid is Cc1cccnc1-c1ccc(CC(NC(=O)c2c(Cl)cc(C(=O)O)cc2Cl)C(=O)O)cc1.
What is the InChIKey of 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid?
The InChIKey is PHWKFKLXDKWQTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18Cl2N2O5/c1-12-3-2-8-26-20(12)14-6-4-13(5-7-14)9-18(23(31)32)27-21(28)19-16(24)10-15(22(29)30)11-17(19)25/h2-8,10-11,18H,9H2,1H3,(H,27,28)(H,29,30)(H,31,32).
What are the key properties of 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid?
4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid has a molecular weight of 473.31 g/mol, XLogP of 4.49, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-carboxy-2-[4-(3-methyl-2-pyridinyl)phenyl]ethyl]carbamoyl]-3,5-dichlorobenzoic acid is sourced from PubChem (CID 142344094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).