C10H21N3 — CID 142345217
ethane;N-ethyl-4,6-dimethyl-1,3-dihydropyrazin-2-imine (PubChem CID 142345217) has the molecular formula C10H21N3 and a molecular weight of 183.30 g/mol. Its IUPAC name is ethane;N-ethyl-4,6-dimethyl-1,3-dihydropyrazin-2-imine.
| Compound Name | ethane;N-ethyl-4,6-dimethyl-1,3-dihydropyrazin-2-imine |
|---|---|
| PubChem CID | 142345217 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | ethane;N-ethyl-4,6-dimethyl-1,3-dihydropyrazin-2-imine |
| SMILES | CC.CC/N=C1\CN(C)C=C(C)N1 |
| InChI | InChI=1S/C8H15N3.C2H6/c1-4-9-8-6-11(3)5-7(2)10-8;1-2/h5H,4,6H2,1-3H3,(H,9,10);1-2H3 |
| InChIKey | RVOVEEBIGQWKER-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|