C20H24BrN3O2S — CID 142345637
6-bromo-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-propan-2-ylsulfanyl-2,3-dihydroindole-4-carboxamide (PubChem CID 142345637) has the molecular formula C20H24BrN3O2S and a molecular weight of 450.40 g/mol. Its IUPAC name is 6-bromo-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-propan-2-ylsulfanyl-2,3-dihydroindole-4-carboxamide.
| Compound Name | 6-bromo-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-propan-2-ylsulfanyl-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 142345637 |
| Molecular Formula | C20H24BrN3O2S |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 6-bromo-N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-1-propan-2-ylsulfanyl-2,3-dihydroindole-4-carboxamide |
| SMILES | Cc1cc(C)c(CNC(=O)c2cc(Br)cc3c2CCN3SC(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C20H24BrN3O2S/c1-11(2)27-24-6-5-15-16(8-14(21)9-18(15)24)19(25)22-10-17-12(3)7-13(4)23-20(17)26/h7-9,11H,5-6,10H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | NGIGTWRONLJKSH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|