C22H30BrN3O3S — CID 142345652
6-bromo-N-[(2E,4Z)-2-formyl-3-methoxy-5-(methylamino)hexa-2,4-dienyl]-3-methyl-1-propan-2-ylsulfanyl-2,3-dihydroindole-4-carboxamide (PubChem CID 142345652) has the molecular formula C22H30BrN3O3S and a molecular weight of 496.47 g/mol. Its IUPAC name is 6-bromo-N-[(2E,4Z)-2-formyl-3-methoxy-5-(methylamino)hexa-2,4-dienyl]-3-methyl-1-propan-2-ylsulfanyl-2,3-dihydroindole-4-carboxamide.
| Compound Name | 6-bromo-N-[(2E,4Z)-2-formyl-3-methoxy-5-(methylamino)hexa-2,4-dienyl]-3-methyl-1-propan-2-ylsulfanyl-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 142345652 |
| Molecular Formula | C22H30BrN3O3S |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 6-bromo-N-[(2E,4Z)-2-formyl-3-methoxy-5-(methylamino)hexa-2,4-dienyl]-3-methyl-1-propan-2-ylsulfanyl-2,3-dihydroindole-4-carboxamide |
| SMILES | CN/C(C)=C\C(OC)=C(/C=O)CNC(=O)c1cc(Br)cc2c1C(C)CN2SC(C)C |
| InChI | InChI=1S/C22H30BrN3O3S/c1-13(2)30-26-11-14(3)21-18(8-17(23)9-19(21)26)22(28)25-10-16(12-27)20(29-6)7-15(4)24-5/h7-9,12-14,24H,10-11H2,1-6H3,(H,25,28)/b15-7-,20-16+ |
| InChIKey | KCFXUAOMXROAPA-IWFLXINRSA-N |
| XLogP | 4.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|