C24H32BrN3O4S — CID 142345715
6-bromo-N-[(2E,4Z)-2-formyl-3-methoxy-5-(methylamino)hexa-2,4-dienyl]-3-methyl-1-(oxan-4-ylsulfanyl)-2,3-dihydroindole-4-carboxamide (PubChem CID 142345715) has the molecular formula C24H32BrN3O4S and a molecular weight of 538.51 g/mol. Its IUPAC name is 6-bromo-N-[(2E,4Z)-2-formyl-3-methoxy-5-(methylamino)hexa-2,4-dienyl]-3-methyl-1-(oxan-4-ylsulfanyl)-2,3-dihydroindole-4-carboxamide.
| Compound Name | 6-bromo-N-[(2E,4Z)-2-formyl-3-methoxy-5-(methylamino)hexa-2,4-dienyl]-3-methyl-1-(oxan-4-ylsulfanyl)-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 142345715 |
| Molecular Formula | C24H32BrN3O4S |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 6-bromo-N-[(2E,4Z)-2-formyl-3-methoxy-5-(methylamino)hexa-2,4-dienyl]-3-methyl-1-(oxan-4-ylsulfanyl)-2,3-dihydroindole-4-carboxamide |
| SMILES | CN/C(C)=C\C(OC)=C(/C=O)CNC(=O)c1cc(Br)cc2c1C(C)CN2SC1CCOCC1 |
| InChI | InChI=1S/C24H32BrN3O4S/c1-15-13-28(33-19-5-7-32-8-6-19)21-11-18(25)10-20(23(15)21)24(30)27-12-17(14-29)22(31-4)9-16(2)26-3/h9-11,14-15,19,26H,5-8,12-13H2,1-4H3,(H,27,30)/b16-9-,22-17+ |
| InChIKey | ZXZAKZQPEDNYTA-ZIZNFBSCSA-N |
| XLogP | 4.15 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|